C10H12N3+ — CID 173179357
5,6,7,10-tetrahydro-1H-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium (PubChem CID 173179357) has the molecular formula C10H12N3+ and a molecular weight of 174.23 g/mol. Its IUPAC name is 5,6,7,10-tetrahydro-1H-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium.
| Compound Name | 5,6,7,10-tetrahydro-1H-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 173179357 |
| Molecular Formula | C10H12N3+ |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 5,6,7,10-tetrahydro-1H-[1,2,4]triazolo[3,4-a]isoquinolin-4-ium |
| SMILES | C1=CCC2=C(C1)CC[n+]1cn[nH]c12 |
| InChI | InChI=1S/C10H11N3/c1-2-4-9-8(3-1)5-6-13-7-11-12-10(9)13/h1-2,7H,3-6H2/p+1 |
| InChIKey | IMOSAHRNJIVWNE-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|