About (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone
(4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone (PubChem CID 173179763) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone |
| PubChem CID | 173179763 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCC(C)N1C(=O)C1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C13H18ClNO/c1-9-3-4-10(2)15(9)13(16)11-5-7-12(14)8-6-11/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | NIQUTIQBQTVQLH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone?
The IUPAC name of (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone (CID 173179763) is (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone.
What is the SMILES notation for (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone?
The canonical SMILES for (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone is CC1CCC(C)N1C(=O)C1=CC=C(Cl)CC1.
What is the InChIKey of (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone?
The InChIKey is NIQUTIQBQTVQLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-9-3-4-10(2)15(9)13(16)11-5-7-12(14)8-6-11/h5,7,9-10H,3-4,6,8H2,1-2H3.
What are the key properties of (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone?
(4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone has a molecular weight of 239.75 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorocyclohexa-1,3-dien-1-yl)-(2,5-dimethylpyrrolidin-1-yl)methanone is sourced from PubChem (CID 173179763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).