C41H51N5O4 — CID 173179935
7-[4-(2-butoxyethoxy)phenyl]-N-[4-[N-hydroxy-C-[(1-propylimidazol-2-yl)methyl]carbonimidoyl]phenyl]-1-(2-methylpropyl)-2,3-dihydro-1-benzazepine-4-carboxamide (PubChem CID 173179935) has the molecular formula C41H51N5O4 and a molecular weight of 677.89 g/mol. Its IUPAC name is 7-[4-(2-butoxyethoxy)phenyl]-N-[4-[N-hydroxy-C-[(1-propylimidazol-2-yl)methyl]carbonimidoyl]phenyl]-1-(2-methylpropyl)-2,3-dihydro-1-benzazepine-4-carboxamide.
| Compound Name | 7-[4-(2-butoxyethoxy)phenyl]-N-[4-[N-hydroxy-C-[(1-propylimidazol-2-yl)methyl]carbonimidoyl]phenyl]-1-(2-methylpropyl)-2,3-dihydro-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 173179935 |
| Molecular Formula | C41H51N5O4 |
| Molecular Weight | 677.89 g/mol |
| Exact Mass | 677.39 |
| IUPAC Name | 7-[4-(2-butoxyethoxy)phenyl]-N-[4-[N-hydroxy-C-[(1-propylimidazol-2-yl)methyl]carbonimidoyl]phenyl]-1-(2-methylpropyl)-2,3-dihydro-1-benzazepine-4-carboxamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(C(Cc4nccn4CCC)=NO)cc2)CCN3CC(C)C)cc1 |
| InChI | InChI=1S/C41H51N5O4/c1-5-7-23-49-24-25-50-37-15-10-31(11-16-37)33-12-17-39-35(26-33)27-34(18-21-46(39)29-30(3)4)41(47)43-36-13-8-32(9-14-36)38(44-48)28-40-42-19-22-45(40)20-6-2/h8-17,19,22,26-27,30,48H,5-7,18,20-21,23-25,28-29H2,1-4H3,(H,43,47) |
| InChIKey | SKLXQWPOOZFFSE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.89 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|