About N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine
N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine (PubChem CID 173180346) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 173180346 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine |
| SMILES | CN(C)C1=CCCC=C1OC(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-13(2)7-5-3-4-6-8(7)14-9(10,11)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | LVSHTXRINLVLEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine (CID 173180346) is N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine is CN(C)C1=CCCC=C1OC(F)(F)F.
What is the InChIKey of N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The InChIKey is LVSHTXRINLVLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO/c1-13(2)7-5-3-4-6-8(7)14-9(10,11)12/h5-6H,3-4H2,1-2H3.
What are the key properties of N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine has a molecular weight of 207.19 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-6-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 173180346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).