C19H27O5P — CID 173180433
[5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-oxopent-4-en-2-yl]phosphonic acid (PubChem CID 173180433) has the molecular formula C19H27O5P and a molecular weight of 366.39 g/mol. Its IUPAC name is [5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-oxopent-4-en-2-yl]phosphonic acid.
| Compound Name | [5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-oxopent-4-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 173180433 |
| Molecular Formula | C19H27O5P |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-oxopent-4-en-2-yl]phosphonic acid |
| SMILES | CC(C(=O)C=Cc1cc(C(C)(C)C)c(O)c2c1CCCC2)P(=O)(O)O |
| InChI | InChI=1S/C19H27O5P/c1-12(25(22,23)24)17(20)10-9-13-11-16(19(2,3)4)18(21)15-8-6-5-7-14(13)15/h9-12,21H,5-8H2,1-4H3,(H2,22,23,24) |
| InChIKey | LEERCONIPOHAAU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|