About CID 173182289
CID 173182289 (PubChem CID 173182289) has the molecular formula C22H18F3Sn
and a molecular weight of 458.09 g/mol.
Molecular Properties
| Compound Name | CID 173182289 |
| PubChem CID | 173182289 |
| Molecular Formula | C22H18F3Sn |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | — |
| SMILES | CCC(c1ccc(F)cc1)C([Sn])(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18F3.Sn/c1-2-21(15-3-9-18(23)10-4-15)22(16-5-11-19(24)12-6-16)17-7-13-20(25)14-8-17;/h3-14,21H,2H2,1H3; |
| InChIKey | SCVMKQVAHPKEDZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173182289 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173182289?
The IUPAC name of CID 173182289 (CID 173182289) is not available.
What is the SMILES notation for CID 173182289?
The canonical SMILES for CID 173182289 is CCC(c1ccc(F)cc1)C([Sn])(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of CID 173182289?
The InChIKey is SCVMKQVAHPKEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3.Sn/c1-2-21(15-3-9-18(23)10-4-15)22(16-5-11-19(24)12-6-16)17-7-13-20(25)14-8-17;/h3-14,21H,2H2,1H3;.
What are the key properties of CID 173182289?
CID 173182289 has a molecular weight of 458.09 g/mol, XLogP of 5.71, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173182289 is sourced from PubChem (CID 173182289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).