About 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione
6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione (PubChem CID 173182351) has the molecular formula C13H12S
and a molecular weight of 200.31 g/mol. Its IUPAC name is 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione |
| PubChem CID | 173182351 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione |
| SMILES | Cc1ccc(C2C=CC=CC2=S)cc1 |
| InChI | InChI=1S/C13H12S/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14/h2-9,12H,1H3 |
| InChIKey | GBRXCIXMPNNVOT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione?
The IUPAC name of 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione (CID 173182351) is 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione?
The canonical SMILES for 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione is Cc1ccc(C2C=CC=CC2=S)cc1.
What is the InChIKey of 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione?
The InChIKey is GBRXCIXMPNNVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12S/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14/h2-9,12H,1H3.
What are the key properties of 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione?
6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione has a molecular weight of 200.31 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylphenyl)cyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 173182351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).