C12H30N4O14S — CID 173182675
bis(2-[[1-aminooxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]acetic acid);sulfuric acid (PubChem CID 173182675) has the molecular formula C12H30N4O14S and a molecular weight of 486.45 g/mol. Its IUPAC name is bis(2-[[1-aminooxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]acetic acid);sulfuric acid.
| Compound Name | bis(2-[[1-aminooxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]acetic acid);sulfuric acid |
|---|---|
| PubChem CID | 173182675 |
| Molecular Formula | C12H30N4O14S |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | bis(2-[[1-aminooxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]acetic acid);sulfuric acid |
| SMILES | NOCC(CO)(CO)NCC(=O)O.NOCC(CO)(CO)NCC(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H14N2O5.H2O4S/c2*7-13-4-6(2-9,3-10)8-1-5(11)12;1-5(2,3)4/h2*8-10H,1-4,7H2,(H,11,12);(H2,1,2,3,4) |
| InChIKey | YPUIWZARKGHLRZ-UHFFFAOYSA-N |
| XLogP | -6.10 |
| TPSA | 324.68 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | -6.10 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|