About 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride
1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride (PubChem CID 173182837) has the molecular formula C9H17ClN2S
and a molecular weight of 220.77 g/mol. Its IUPAC name is 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride.
Molecular Properties
| Compound Name | 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride |
| PubChem CID | 173182837 |
| Molecular Formula | C9H17ClN2S |
| Molecular Weight | 220.77 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride |
| SMILES | CCN1C=CC(C)N(CC)C1=S.Cl |
| InChI | InChI=1S/C9H16N2S.ClH/c1-4-10-7-6-8(3)11(5-2)9(10)12;/h6-8H,4-5H2,1-3H3;1H |
| InChIKey | HOWGUXDCTLJQAV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride?
The IUPAC name of 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride (CID 173182837) is 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride.
What is the SMILES notation for 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride?
The canonical SMILES for 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride is CCN1C=CC(C)N(CC)C1=S.Cl.
What is the InChIKey of 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride?
The InChIKey is HOWGUXDCTLJQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S.ClH/c1-4-10-7-6-8(3)11(5-2)9(10)12;/h6-8H,4-5H2,1-3H3;1H.
What are the key properties of 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride?
1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride has a molecular weight of 220.77 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-4-methyl-4H-pyrimidine-2-thione;hydrochloride is sourced from PubChem (CID 173182837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).