C20H37N3O5S2Si — CID 173183404
[1-[4-[[(4S,5S)-3-dimethylsilyloxy-2,2,5-trimethylheptan-4-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate (PubChem CID 173183404) has the molecular formula C20H37N3O5S2Si and a molecular weight of 491.75 g/mol. Its IUPAC name is [1-[4-[[(4S,5S)-3-dimethylsilyloxy-2,2,5-trimethylheptan-4-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[4-[[(4S,5S)-3-dimethylsilyloxy-2,2,5-trimethylheptan-4-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 173183404 |
| Molecular Formula | C20H37N3O5S2Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [1-[4-[[(4S,5S)-3-dimethylsilyloxy-2,2,5-trimethylheptan-4-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1csc(N2CC(OS(C)(=O)=O)C2)n1)C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C20H37N3O5S2Si/c1-9-13(2)16(17(20(3,4)5)28-31(7)8)22-18(24)15-12-29-19(21-15)23-10-14(11-23)27-30(6,25)26/h12-14,16-17,31H,9-11H2,1-8H3,(H,22,24)/t13-,16-,17?/m0/s1 |
| InChIKey | PFWDACPLKBUPTM-CCBDSKLWSA-N |
| XLogP | 2.87 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|