C28H35N3O2SSi — CID 173183409
[2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 173183409) has the molecular formula C28H35N3O2SSi and a molecular weight of 505.76 g/mol. Its IUPAC name is [2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 173183409 |
| Molecular Formula | C28H35N3O2SSi |
| Molecular Weight | 505.76 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | CC(C)(C)C1CN(c2nc(C(=O)N3CCCCC3)cs2)C1O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35N3O2SSi/c1-28(2,3)23-19-31(27-29-24(20-34-27)25(32)30-17-11-6-12-18-30)26(23)33-35(21-13-7-4-8-14-21)22-15-9-5-10-16-22/h4-5,7-10,13-16,20,23,26,35H,6,11-12,17-19H2,1-3H3 |
| InChIKey | ZRMUBWAUFIHICD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|