C42H51N3O3SSi2 — CID 173183474
2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 173183474) has the molecular formula C42H51N3O3SSi2 and a molecular weight of 734.13 g/mol. Its IUPAC name is 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173183474 |
| Molecular Formula | C42H51N3O3SSi2 |
| Molecular Weight | 734.13 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)c1csc(N2CC(C(C)(C)C)C2O[SiH](c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C42H51N3O3SSi2/c1-41(2,3)36-30-45(39(36)48-50(32-20-12-8-13-21-32)33-22-14-9-15-23-33)40-43-37(31-49-40)38(46)44(7)28-29-47-51(42(4,5)6,34-24-16-10-17-25-34)35-26-18-11-19-27-35/h8-27,31,36,39,50H,28-30H2,1-7H3 |
| InChIKey | SVAAHEPYXHZOOL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.13 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|