About 2-methylpropane;stibane
2-methylpropane;stibane (PubChem CID 173183868) has the molecular formula C4H16Sb2
and a molecular weight of 307.69 g/mol. Its IUPAC name is 2-methylpropane;stibane.
Molecular Properties
| Compound Name | 2-methylpropane;stibane |
| PubChem CID | 173183868 |
| Molecular Formula | C4H16Sb2 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-methylpropane;stibane |
| SMILES | CC(C)C.[SbH3].[SbH3] |
| InChI | InChI=1S/C4H10.2Sb.6H/c1-4(2)3;;;;;;;;/h4H,1-3H3;;;;;;;; |
| InChIKey | MKGLKHZLMRQDOV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;stibane?
The IUPAC name of 2-methylpropane;stibane (CID 173183868) is 2-methylpropane;stibane.
What is the SMILES notation for 2-methylpropane;stibane?
The canonical SMILES for 2-methylpropane;stibane is CC(C)C.[SbH3].[SbH3].
What is the InChIKey of 2-methylpropane;stibane?
The InChIKey is MKGLKHZLMRQDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.2Sb.6H/c1-4(2)3;;;;;;;;/h4H,1-3H3;;;;;;;;.
What are the key properties of 2-methylpropane;stibane?
2-methylpropane;stibane has a molecular weight of 307.69 g/mol, XLogP of -0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;stibane is sourced from PubChem (CID 173183868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).