About 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal
3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal (PubChem CID 173184268) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal |
| PubChem CID | 173184268 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal |
| SMILES | CCCN(C)C(C=O)CC1=CCCC=C1 |
| InChI | InChI=1S/C13H21NO/c1-3-9-14(2)13(11-15)10-12-7-5-4-6-8-12/h5,7-8,11,13H,3-4,6,9-10H2,1-2H3 |
| InChIKey | RIUBTQOCLWDCGP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal (CID 173184268) is 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal is CCCN(C)C(C=O)CC1=CCCC=C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal?
The InChIKey is RIUBTQOCLWDCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-3-9-14(2)13(11-15)10-12-7-5-4-6-8-12/h5,7-8,11,13H,3-4,6,9-10H2,1-2H3.
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal?
3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal has a molecular weight of 207.32 g/mol, XLogP of 2.56, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-2-[methyl(propyl)amino]propanal is sourced from PubChem (CID 173184268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).