About 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine
3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine (PubChem CID 173184317) has the molecular formula C13H20FNO
and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine.
Molecular Properties
| Compound Name | 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine |
| PubChem CID | 173184317 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine |
| SMILES | CN1CCCC(COC2=CCCC=C2F)C1 |
| InChI | InChI=1S/C13H20FNO/c1-15-8-4-5-11(9-15)10-16-13-7-3-2-6-12(13)14/h6-7,11H,2-5,8-10H2,1H3 |
| InChIKey | XZPLRNPBNJRPMF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine?
The IUPAC name of 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine (CID 173184317) is 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine.
What is the SMILES notation for 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine?
The canonical SMILES for 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine is CN1CCCC(COC2=CCCC=C2F)C1.
What is the InChIKey of 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine?
The InChIKey is XZPLRNPBNJRPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO/c1-15-8-4-5-11(9-15)10-16-13-7-3-2-6-12(13)14/h6-7,11H,2-5,8-10H2,1H3.
What are the key properties of 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine?
3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine has a molecular weight of 225.31 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]-1-methylpiperidine is sourced from PubChem (CID 173184317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).