C20H22ClNO2 — CID 173184334
[1-(5-chloro-2-methylphenyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 173184334) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is [1-(5-chloro-2-methylphenyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(5-chloro-2-methylphenyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 173184334 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [1-(5-chloro-2-methylphenyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(c3cc(Cl)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-14-3-6-17(21)13-19(14)22-11-9-16(10-12-22)20(23)15-4-7-18(24-2)8-5-15/h3-8,13,16H,9-12H2,1-2H3 |
| InChIKey | GOXKGRJLFHXLSI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |