C40H34N6O2 — CID 173184873
N-[3-[1-(oxan-2-yl)-5-(5-trityl-1H-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]formamide (PubChem CID 173184873) has the molecular formula C40H34N6O2 and a molecular weight of 630.75 g/mol. Its IUPAC name is N-[3-[1-(oxan-2-yl)-5-(5-trityl-1H-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]formamide.
| Compound Name | N-[3-[1-(oxan-2-yl)-5-(5-trityl-1H-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]formamide |
|---|---|
| PubChem CID | 173184873 |
| Molecular Formula | C40H34N6O2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | N-[3-[1-(oxan-2-yl)-5-(5-trityl-1H-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]formamide |
| SMILES | O=CNc1cccc(-c2nn(C3CCCCO3)c3ccc(-c4n[nH]c(C(c5ccccc5)(c5ccccc5)c5ccccc5)n4)cc23)c1 |
| InChI | InChI=1S/C40H34N6O2/c47-27-41-33-20-12-13-28(25-33)37-34-26-29(22-23-35(34)46(45-37)36-21-10-11-24-48-36)38-42-39(44-43-38)40(30-14-4-1-5-15-30,31-16-6-2-7-17-31)32-18-8-3-9-19-32/h1-9,12-20,22-23,25-27,36H,10-11,21,24H2,(H,41,47)(H,42,43,44) |
| InChIKey | IDTXNTSPSXPTCW-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|