C23H25N3O9 — CID 173184958
2-[3-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetic acid (PubChem CID 173184958) has the molecular formula C23H25N3O9 and a molecular weight of 487.47 g/mol. Its IUPAC name is 2-[3-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetic acid.
| Compound Name | 2-[3-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 173184958 |
| Molecular Formula | C23H25N3O9 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[3-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)COc1cc(OCC(=O)O)ccc1C(=O)CN1C=C2C=CC(C(N)=NO)C(=O)C2C1 |
| InChI | InChI=1S/C23H25N3O9/c1-2-33-21(30)12-35-19-7-14(34-11-20(28)29)4-6-15(19)18(27)10-26-8-13-3-5-16(23(24)25-32)22(31)17(13)9-26/h3-8,16-17,32H,2,9-12H2,1H3,(H2,24,25)(H,28,29) |
| InChIKey | YQWKFYLOQXWKNC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 178.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|