About 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine
1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine (PubChem CID 173185148) has the molecular formula C18H16N6
and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine.
Molecular Properties
| Compound Name | 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine |
| PubChem CID | 173185148 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine |
| SMILES | Cc1ccc(-c2ncn[nH]2)cc1-n1ncc(-c2ccccc2)c1N |
| InChI | InChI=1S/C18H16N6/c1-12-7-8-14(18-20-11-21-23-18)9-16(12)24-17(19)15(10-22-24)13-5-3-2-4-6-13/h2-11H,19H2,1H3,(H,20,21,23) |
| InChIKey | FVWCXPWDMFCVJV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine?
The IUPAC name of 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine (CID 173185148) is 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine.
What is the SMILES notation for 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine?
The canonical SMILES for 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine is Cc1ccc(-c2ncn[nH]2)cc1-n1ncc(-c2ccccc2)c1N.
What is the InChIKey of 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine?
The InChIKey is FVWCXPWDMFCVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6/c1-12-7-8-14(18-20-11-21-23-18)9-16(12)24-17(19)15(10-22-24)13-5-3-2-4-6-13/h2-11H,19H2,1H3,(H,20,21,23).
What are the key properties of 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine?
1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine has a molecular weight of 316.37 g/mol, XLogP of 3.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methyl-5-(1H-1,2,4-triazol-5-yl)phenyl]-4-phenylpyrazol-5-amine is sourced from PubChem (CID 173185148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).