About 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline
2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline (PubChem CID 173185429) has the molecular formula C13H10ClN3
and a molecular weight of 243.70 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline |
| PubChem CID | 173185429 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline |
| SMILES | Clc1ncccc1C1=NCc2ccccc2N1 |
| InChI | InChI=1S/C13H10ClN3/c14-12-10(5-3-7-15-12)13-16-8-9-4-1-2-6-11(9)17-13/h1-7H,8H2,(H,16,17) |
| InChIKey | AWZBDVPZEKLQEZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline?
The IUPAC name of 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline (CID 173185429) is 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline.
What is the SMILES notation for 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline?
The canonical SMILES for 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline is Clc1ncccc1C1=NCc2ccccc2N1.
What is the InChIKey of 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline?
The InChIKey is AWZBDVPZEKLQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3/c14-12-10(5-3-7-15-12)13-16-8-9-4-1-2-6-11(9)17-13/h1-7H,8H2,(H,16,17).
What are the key properties of 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline?
2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline has a molecular weight of 243.70 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-3-pyridinyl)-1,4-dihydroquinazoline is sourced from PubChem (CID 173185429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).