C27H23ClN2O3 — CID 173185440
4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-hydroxy-4-naphthalen-1-ylbut-1-enyl]benzoic acid (PubChem CID 173185440) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-hydroxy-4-naphthalen-1-ylbut-1-enyl]benzoic acid.
| Compound Name | 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-hydroxy-4-naphthalen-1-ylbut-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 173185440 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-hydroxy-4-naphthalen-1-ylbut-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(CNc2cccnc2Cl)CC(O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H23ClN2O3/c28-26-24(9-4-14-29-26)30-17-19(15-18-10-12-21(13-11-18)27(32)33)16-25(31)23-8-3-6-20-5-1-2-7-22(20)23/h1-15,25,30-31H,16-17H2,(H,32,33) |
| InChIKey | KLXCAVNEEJCLLJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|