About 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide
2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide (PubChem CID 173185596) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide.
Molecular Properties
| Compound Name | 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide |
| PubChem CID | 173185596 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide |
| SMILES | NC(=O)N1C(=O)COc2ncccc21 |
| InChI | InChI=1S/C8H7N3O3/c9-8(13)11-5-2-1-3-10-7(5)14-4-6(11)12/h1-3H,4H2,(H2,9,13) |
| InChIKey | XCBFNDABLSWKBN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide?
The IUPAC name of 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide (CID 173185596) is 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide.
What is the SMILES notation for 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide?
The canonical SMILES for 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide is NC(=O)N1C(=O)COc2ncccc21.
What is the InChIKey of 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide?
The InChIKey is XCBFNDABLSWKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c9-8(13)11-5-2-1-3-10-7(5)14-4-6(11)12/h1-3H,4H2,(H2,9,13).
What are the key properties of 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide?
2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide has a molecular weight of 193.16 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyrido[2,3-b][1,4]oxazine-1-carboxamide is sourced from PubChem (CID 173185596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).