H6O6P2PbS2 — CID 173186715
CID 173186715 (PubChem CID 173186715) has the molecular formula H6O6P2PbS2 and a molecular weight of 435.32 g/mol.
| Compound Name | CID 173186715 |
|---|---|
| PubChem CID | 173186715 |
| Molecular Formula | H6O6P2PbS2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.88 |
| IUPAC Name | — |
| SMILES | OP(O)(O)=S.OP(O)(O)=S.[Pb] |
| InChI | InChI=1S/2H3O3PS.Pb/c2*1-4(2,3)5;/h2*(H3,1,2,3,5); |
| InChIKey | PZJFJRAUXIUPTB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|