C19H19FN2O5 — CID 173186918
(3S,6S,10aS)-6-(2-fluoro-N-oxaldehydoylanilino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxylic acid (PubChem CID 173186918) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is (3S,6S,10aS)-6-(2-fluoro-N-oxaldehydoylanilino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxylic acid.
| Compound Name | (3S,6S,10aS)-6-(2-fluoro-N-oxaldehydoylanilino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxylic acid |
|---|---|
| PubChem CID | 173186918 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (3S,6S,10aS)-6-(2-fluoro-N-oxaldehydoylanilino)-5-oxo-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxylic acid |
| SMILES | O=CC(=O)N(c1ccccc1F)[C@H]1CC=CC[C@@H]2CC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C19H19FN2O5/c20-13-6-2-4-7-14(13)22(17(24)11-23)15-8-3-1-5-12-9-10-16(19(26)27)21(12)18(15)25/h1-4,6-7,11-12,15-16H,5,8-10H2,(H,26,27)/t12-,15+,16+/m1/s1 |
| InChIKey | URMFWGQIEHHRPP-KCXAZCMYSA-N |
| XLogP | 1.52 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|