About 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane
1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane (PubChem CID 173187116) has the molecular formula C11H28N2O3Si
and a molecular weight of 264.44 g/mol. Its IUPAC name is 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane.
Molecular Properties
| Compound Name | 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane |
| PubChem CID | 173187116 |
| Molecular Formula | C11H28N2O3Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane |
| SMILES | CC(N)N1CC1C.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H16O3Si.C5H12N2/c1-4-7-10(8-5-2)9-6-3;1-4-3-7(4)5(2)6/h10H,4-6H2,1-3H3;4-5H,3,6H2,1-2H3 |
| InChIKey | CXIDAYRURYPHAF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 56.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane?
The IUPAC name of 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane (CID 173187116) is 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane.
What is the SMILES notation for 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane?
The canonical SMILES for 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane is CC(N)N1CC1C.CCO[SiH](OCC)OCC.
What is the InChIKey of 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane?
The InChIKey is CXIDAYRURYPHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C5H12N2/c1-4-7-10(8-5-2)9-6-3;1-4-3-7(4)5(2)6/h10H,4-6H2,1-3H3;4-5H,3,6H2,1-2H3.
What are the key properties of 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane?
1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane has a molecular weight of 264.44 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylaziridin-1-yl)ethanamine;triethoxysilane is sourced from PubChem (CID 173187116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).