About 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid
2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 173188664) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 173188664 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | O=C(O)CC1C=CC=CC1=S |
| InChI | InChI=1S/C8H8O2S/c9-8(10)5-6-3-1-2-4-7(6)11/h1-4,6H,5H2,(H,9,10) |
| InChIKey | PDAXPKBGOJUNBU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid (CID 173188664) is 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid is O=C(O)CC1C=CC=CC1=S.
What is the InChIKey of 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is PDAXPKBGOJUNBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c9-8(10)5-6-3-1-2-4-7(6)11/h1-4,6H,5H2,(H,9,10).
What are the key properties of 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid?
2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 168.22 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 173188664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).