C6H12Cl3NO4 — CID 173188984
1-(1-hydroxyethylamino)ethanol;2,2,2-trichloroacetic acid (PubChem CID 173188984) has the molecular formula C6H12Cl3NO4 and a molecular weight of 268.52 g/mol. Its IUPAC name is 1-(1-hydroxyethylamino)ethanol;2,2,2-trichloroacetic acid.
| Compound Name | 1-(1-hydroxyethylamino)ethanol;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 173188984 |
| Molecular Formula | C6H12Cl3NO4 |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 1-(1-hydroxyethylamino)ethanol;2,2,2-trichloroacetic acid |
| SMILES | CC(O)NC(C)O.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H11NO2.C2HCl3O2/c1-3(6)5-4(2)7;3-2(4,5)1(6)7/h3-7H,1-2H3;(H,6,7) |
| InChIKey | IKWYMASHKMPGMX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|