About dioxido(oxo)silane;bis(lead(2+));oxygen(2-)
dioxido(oxo)silane;bis(lead(2+));oxygen(2-) (PubChem CID 173189468) has the molecular formula O4Pb2Si
and a molecular weight of 506.48 g/mol. Its IUPAC name is dioxido(oxo)silane;bis(lead(2+));oxygen(2-).
Molecular Properties
| Compound Name | dioxido(oxo)silane;bis(lead(2+));oxygen(2-) |
|---|
| PubChem CID | 173189468 |
|---|
| Molecular Formula | O4Pb2Si |
|---|
| Molecular Weight | 506.48 g/mol |
|---|
| Exact Mass | 507.91 |
|---|
| IUPAC Name | dioxido(oxo)silane;bis(lead(2+));oxygen(2-) |
|---|
| SMILES | O=[Si]([O-])[O-].[O-2].[Pb+2].[Pb+2] |
|---|
| InChI | InChI=1S/O3Si.O.2Pb/c1-4(2)3;;;/q2*-2;2*+2 |
|---|
| InChIKey | TUDVOXLDSVOKTN-UHFFFAOYSA-N |
|---|
| XLogP | -3.76 |
|---|
| TPSA | 91.69 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 7 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;bis(lead(2+));oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;bis(lead(2+));oxygen(2-)?
The IUPAC name of dioxido(oxo)silane;bis(lead(2+));oxygen(2-) (CID 173189468) is dioxido(oxo)silane;bis(lead(2+));oxygen(2-).
What is the SMILES notation for dioxido(oxo)silane;bis(lead(2+));oxygen(2-)?
The canonical SMILES for dioxido(oxo)silane;bis(lead(2+));oxygen(2-) is O=[Si]([O-])[O-].[O-2].[Pb+2].[Pb+2].
What is the InChIKey of dioxido(oxo)silane;bis(lead(2+));oxygen(2-)?
The InChIKey is TUDVOXLDSVOKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/O3Si.O.2Pb/c1-4(2)3;;;/q2*-2;2*+2.
What are the key properties of dioxido(oxo)silane;bis(lead(2+));oxygen(2-)?
dioxido(oxo)silane;bis(lead(2+));oxygen(2-) has a molecular weight of 506.48 g/mol, XLogP of -3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;bis(lead(2+));oxygen(2-) is sourced from PubChem (CID 173189468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).