About disodium;acetic acid;2-(methylamino)acetate;acetate
disodium;acetic acid;2-(methylamino)acetate;acetate (PubChem CID 173189557) has the molecular formula C7H13NNa2O6
and a molecular weight of 253.16 g/mol. Its IUPAC name is disodium;acetic acid;2-(methylamino)acetate;acetate.
Molecular Properties
| Compound Name | disodium;acetic acid;2-(methylamino)acetate;acetate |
| PubChem CID | 173189557 |
| Molecular Formula | C7H13NNa2O6 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | disodium;acetic acid;2-(methylamino)acetate;acetate |
| SMILES | CC(=O)O.CC(=O)[O-].CNCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H7NO2.2C2H4O2.2Na/c1-4-2-3(5)6;2*1-2(3)4;;/h4H,2H2,1H3,(H,5,6);2*1H3,(H,3,4);;/q;;;2*+1/p-2 |
| InChIKey | AVSIKTKNSBXVBS-UHFFFAOYSA-L |
| XLogP | -9.19 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | -9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze disodium;acetic acid;2-(methylamino)acetate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;acetic acid;2-(methylamino)acetate;acetate?
The IUPAC name of disodium;acetic acid;2-(methylamino)acetate;acetate (CID 173189557) is disodium;acetic acid;2-(methylamino)acetate;acetate.
What is the SMILES notation for disodium;acetic acid;2-(methylamino)acetate;acetate?
The canonical SMILES for disodium;acetic acid;2-(methylamino)acetate;acetate is CC(=O)O.CC(=O)[O-].CNCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;acetic acid;2-(methylamino)acetate;acetate?
The InChIKey is AVSIKTKNSBXVBS-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7NO2.2C2H4O2.2Na/c1-4-2-3(5)6;2*1-2(3)4;;/h4H,2H2,1H3,(H,5,6);2*1H3,(H,3,4);;/q;;;2*+1/p-2.
What are the key properties of disodium;acetic acid;2-(methylamino)acetate;acetate?
disodium;acetic acid;2-(methylamino)acetate;acetate has a molecular weight of 253.16 g/mol, XLogP of -9.19, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;acetic acid;2-(methylamino)acetate;acetate is sourced from PubChem (CID 173189557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).