About 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene
1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene (PubChem CID 173189729) has the molecular formula C21H19F3
and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene |
| PubChem CID | 173189729 |
| Molecular Formula | C21H19F3 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene |
| SMILES | Cc1ccc(C2=C(c3cccc(C)c3)CCC=C2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3/c1-14-9-11-16(12-10-14)20-18(17-6-3-5-15(2)13-17)7-4-8-19(20)21(22,23)24/h3,5-6,8-13H,4,7H2,1-2H3 |
| InChIKey | CFQWJHCTZQIRQQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene?
The IUPAC name of 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene (CID 173189729) is 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene.
What is the SMILES notation for 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene?
The canonical SMILES for 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene is Cc1ccc(C2=C(c3cccc(C)c3)CCC=C2C(F)(F)F)cc1.
What is the InChIKey of 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene?
The InChIKey is CFQWJHCTZQIRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3/c1-14-9-11-16(12-10-14)20-18(17-6-3-5-15(2)13-17)7-4-8-19(20)21(22,23)24/h3,5-6,8-13H,4,7H2,1-2H3.
What are the key properties of 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene?
1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene has a molecular weight of 328.38 g/mol, XLogP of 6.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-(4-methylphenyl)-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]benzene is sourced from PubChem (CID 173189729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).