About potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride
potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride (PubChem CID 173191033) has the molecular formula C16H21BrKNO4
and a molecular weight of 410.35 g/mol. Its IUPAC name is potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride.
Molecular Properties
| Compound Name | potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride |
| PubChem CID | 173191033 |
| Molecular Formula | C16H21BrKNO4 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride |
| SMILES | O=CNCOC(=O)C1(OCc2ccc(Br)cc2)CCCCC1.[H-].[K+] |
| InChI | InChI=1S/C16H20BrNO4.K.H/c17-14-6-4-13(5-7-14)10-22-16(8-2-1-3-9-16)15(20)21-12-18-11-19;;/h4-7,11H,1-3,8-10,12H2,(H,18,19);;/q;+1;-1 |
| InChIKey | GVLIKZGTTKJTNW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride?
The IUPAC name of potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride (CID 173191033) is potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride.
What is the SMILES notation for potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride?
The canonical SMILES for potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride is O=CNCOC(=O)C1(OCc2ccc(Br)cc2)CCCCC1.[H-].[K+].
What is the InChIKey of potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride?
The InChIKey is GVLIKZGTTKJTNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrNO4.K.H/c17-14-6-4-13(5-7-14)10-22-16(8-2-1-3-9-16)15(20)21-12-18-11-19;;/h4-7,11H,1-3,8-10,12H2,(H,18,19);;/q;+1;-1.
What are the key properties of potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride?
potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride has a molecular weight of 410.35 g/mol, XLogP of 0.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;formamidomethyl 1-[(4-bromophenyl)methoxy]cyclohexane-1-carboxylate;hydride is sourced from PubChem (CID 173191033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).