C24H25N3O4S — CID 173192177
4-[1-(3-benzylsulfanylpropanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carbonyl]benzamide (PubChem CID 173192177) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-[1-(3-benzylsulfanylpropanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carbonyl]benzamide.
| Compound Name | 4-[1-(3-benzylsulfanylpropanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carbonyl]benzamide |
|---|---|
| PubChem CID | 173192177 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-[1-(3-benzylsulfanylpropanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carbonyl]benzamide |
| SMILES | NC(=O)c1ccc(C(=O)N2CC(=O)C3C2CCN3C(=O)CCSCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O4S/c25-23(30)17-6-8-18(9-7-17)24(31)27-14-20(28)22-19(27)10-12-26(22)21(29)11-13-32-15-16-4-2-1-3-5-16/h1-9,19,22H,10-15H2,(H2,25,30) |
| InChIKey | AVYQVLUOJZQNKO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|