C11H20O2Si — CID 173193263
bicyclo[2.2.1]hept-2-ene-1-carboxylic acid;trimethylsilane (PubChem CID 173193263) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene-1-carboxylic acid;trimethylsilane.
| Compound Name | bicyclo[2.2.1]hept-2-ene-1-carboxylic acid;trimethylsilane |
|---|---|
| PubChem CID | 173193263 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-1-carboxylic acid;trimethylsilane |
| SMILES | C[SiH](C)C.O=C(O)C12C=CC(CC1)C2 |
| InChI | InChI=1S/C8H10O2.C3H10Si/c9-7(10)8-3-1-6(5-8)2-4-8;1-4(2)3/h1,3,6H,2,4-5H2,(H,9,10);4H,1-3H3 |
| InChIKey | XIJSVDUNFYMJKG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|