C25H33NO3 — CID 173194772
(10E)-2,4,5,6-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaene-3,20,22-trione (PubChem CID 173194772) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (10E)-2,4,5,6-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaene-3,20,22-trione.
| Compound Name | (10E)-2,4,5,6-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaene-3,20,22-trione |
|---|---|
| PubChem CID | 173194772 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (10E)-2,4,5,6-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaene-3,20,22-trione |
| SMILES | CC1=CCC/C=C/CCCCCCC2=CC(=O)C=C(C2=O)N(C)C(=O)C(C)=C1C |
| InChI | InChI=1S/C25H33NO3/c1-18-14-12-10-8-6-5-7-9-11-13-15-21-16-22(27)17-23(24(21)28)26(4)25(29)20(3)19(18)2/h6,8,14,16-17H,5,7,9-13,15H2,1-4H3/b8-6+,18-14?,20-19? |
| InChIKey | JXBMVXGJQDQIAW-NMTFMGMVSA-N |
| XLogP | 5.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|