C19H17Cl3O3P+ — CID 173194919
oxo-[1-oxo-1-(2,4,6-trichlorophenyl)propan-2-yl]-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 173194919) has the molecular formula C19H17Cl3O3P+ and a molecular weight of 430.68 g/mol. Its IUPAC name is oxo-[1-oxo-1-(2,4,6-trichlorophenyl)propan-2-yl]-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | oxo-[1-oxo-1-(2,4,6-trichlorophenyl)propan-2-yl]-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 173194919 |
| Molecular Formula | C19H17Cl3O3P+ |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | oxo-[1-oxo-1-(2,4,6-trichlorophenyl)propan-2-yl]-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](=O)C(C)C(=O)c2c(Cl)cc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C19H17Cl3O3P/c1-9-5-10(2)16(11(3)6-9)19(24)26(25)12(4)18(23)17-14(21)7-13(20)8-15(17)22/h5-8,12H,1-4H3/q+1 |
| InChIKey | SNRXMVPHYCFGTC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|