About butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium
butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium (PubChem CID 173194990) has the molecular formula C20H30O2P+
and a molecular weight of 333.43 g/mol. Its IUPAC name is butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium.
Molecular Properties
| Compound Name | butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium |
| PubChem CID | 173194990 |
| Molecular Formula | C20H30O2P+ |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium |
| SMILES | CCC(C)[P+](=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCCC1 |
| InChI | InChI=1S/C20H30O2P/c1-6-17(5)23(22)20(10-8-7-9-11-20)19(21)18-15(3)12-14(2)13-16(18)4/h12-13,17H,6-11H2,1-5H3/q+1 |
| InChIKey | IFBIEYQIANCXSP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium?
The IUPAC name of butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium (CID 173194990) is butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium.
What is the SMILES notation for butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium?
The canonical SMILES for butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium is CCC(C)[P+](=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCCC1.
What is the InChIKey of butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium?
The InChIKey is IFBIEYQIANCXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O2P/c1-6-17(5)23(22)20(10-8-7-9-11-20)19(21)18-15(3)12-14(2)13-16(18)4/h12-13,17H,6-11H2,1-5H3/q+1.
What are the key properties of butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium?
butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium has a molecular weight of 333.43 g/mol, XLogP of 6.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]phosphanium is sourced from PubChem (CID 173194990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).