C17H25NO4Si — CID 173195102
(3S,4R)-4-[2-(3-methoxyphenyl)-2-oxoethyl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-2-one (PubChem CID 173195102) has the molecular formula C17H25NO4Si and a molecular weight of 335.48 g/mol. Its IUPAC name is (3S,4R)-4-[2-(3-methoxyphenyl)-2-oxoethyl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-2-one.
| Compound Name | (3S,4R)-4-[2-(3-methoxyphenyl)-2-oxoethyl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 173195102 |
| Molecular Formula | C17H25NO4Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (3S,4R)-4-[2-(3-methoxyphenyl)-2-oxoethyl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-2-one |
| SMILES | COc1cccc(C(=O)C[C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO4Si/c1-11(22-23(3,4)5)16-14(18-17(16)20)10-15(19)12-7-6-8-13(9-12)21-2/h6-9,11,14,16H,10H2,1-5H3,(H,18,20)/t11-,14-,16-/m1/s1 |
| InChIKey | GUADTBXKQIKNAN-DJSGYFEHSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|