About 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole
2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole (PubChem CID 173195232) has the molecular formula C13H15NOS
and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole |
| PubChem CID | 173195232 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole |
| SMILES | Cc1ccc(OCCc2nccs2)cc1C |
| InChI | InChI=1S/C13H15NOS/c1-10-3-4-12(9-11(10)2)15-7-5-13-14-6-8-16-13/h3-4,6,8-9H,5,7H2,1-2H3 |
| InChIKey | PQSSLLDJXJIVMX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole?
The IUPAC name of 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole (CID 173195232) is 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole.
What is the SMILES notation for 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole?
The canonical SMILES for 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole is Cc1ccc(OCCc2nccs2)cc1C.
What is the InChIKey of 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole?
The InChIKey is PQSSLLDJXJIVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NOS/c1-10-3-4-12(9-11(10)2)15-7-5-13-14-6-8-16-13/h3-4,6,8-9H,5,7H2,1-2H3.
What are the key properties of 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole?
2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole has a molecular weight of 233.34 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethylphenoxy)ethyl]-1,3-thiazole is sourced from PubChem (CID 173195232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).