C18H16ClN3O2S — CID 17319563
4-chloro-N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 17319563) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 4-chloro-N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17319563 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-chloro-N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(CCCOc2ccccc2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O2S/c19-14-10-8-13(9-11-14)17(23)20-18-22-21-16(25-18)7-4-12-24-15-5-2-1-3-6-15/h1-3,5-6,8-11H,4,7,12H2,(H,20,22,23) |
| InChIKey | GLQRUVGKFQKRJV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|