C27H42IN3OSe — CID 173195797
7-N,7-N-dibutyl-1-methoxy-3-N,3-N-dipropyl-10H-phenoselenazine-3,7-diamine;hydroiodide (PubChem CID 173195797) has the molecular formula C27H42IN3OSe and a molecular weight of 630.52 g/mol. Its IUPAC name is 7-N,7-N-dibutyl-1-methoxy-3-N,3-N-dipropyl-10H-phenoselenazine-3,7-diamine;hydroiodide.
| Compound Name | 7-N,7-N-dibutyl-1-methoxy-3-N,3-N-dipropyl-10H-phenoselenazine-3,7-diamine;hydroiodide |
|---|---|
| PubChem CID | 173195797 |
| Molecular Formula | C27H42IN3OSe |
| Molecular Weight | 630.52 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | 7-N,7-N-dibutyl-1-methoxy-3-N,3-N-dipropyl-10H-phenoselenazine-3,7-diamine;hydroiodide |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)[Se]c1cc(N(CCC)CCC)cc(OC)c1N2.I |
| InChI | InChI=1S/C27H41N3OSe.HI/c1-6-10-16-30(17-11-7-2)21-12-13-23-25(19-21)32-26-20-22(29(14-8-3)15-9-4)18-24(31-5)27(26)28-23;/h12-13,18-20,28H,6-11,14-17H2,1-5H3;1H |
| InChIKey | KPDAPGIFMKGZTI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|