About 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine
3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 173195907) has the molecular formula C11H18FNO
and a molecular weight of 199.27 g/mol. Its IUPAC name is 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 173195907 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOC1=CCCC=C1F |
| InChI | InChI=1S/C11H18FNO/c1-13(2)8-5-9-14-11-7-4-3-6-10(11)12/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | ZUTOQISRGDJOIW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine (CID 173195907) is 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine is CN(C)CCCOC1=CCCC=C1F.
What is the InChIKey of 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine?
The InChIKey is ZUTOQISRGDJOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FNO/c1-13(2)8-5-9-14-11-7-4-3-6-10(11)12/h6-7H,3-5,8-9H2,1-2H3.
What are the key properties of 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine?
3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine has a molecular weight of 199.27 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluorocyclohexa-1,5-dien-1-yl)oxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 173195907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).