About 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol
5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol (PubChem CID 173195912) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 173195912 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1NC=C(CO)C=C1O |
| InChI | InChI=1S/C7H11NO2/c1-5-7(10)2-6(4-9)3-8-5/h2-3,5,8-10H,4H2,1H3 |
| InChIKey | BJCKAASPDDEXOA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol (CID 173195912) is 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol is CC1NC=C(CO)C=C1O.
What is the InChIKey of 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The InChIKey is BJCKAASPDDEXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-5-7(10)2-6(4-9)3-8-5/h2-3,5,8-10H,4H2,1H3.
What are the key properties of 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol has a molecular weight of 141.17 g/mol, XLogP of 0.30, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 173195912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).