C31H29F3N4O6S2 — CID 173196081
2-methylbenzenesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-thiazole (PubChem CID 173196081) has the molecular formula C31H29F3N4O6S2 and a molecular weight of 674.72 g/mol. Its IUPAC name is 2-methylbenzenesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-thiazole.
| Compound Name | 2-methylbenzenesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 173196081 |
| Molecular Formula | C31H29F3N4O6S2 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | 2-methylbenzenesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-thiazole |
| SMILES | Cc1ccccc1S(=O)(=O)O.FC(F)(F)Oc1ccc(C=Cc2nc(COc3ccc(COCCn4ccnn4)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H21F3N4O3S.C7H8O3S/c25-24(26,27)34-22-8-1-18(2-9-22)5-10-23-29-20(17-35-23)16-33-21-6-3-19(4-7-21)15-32-14-13-31-12-11-28-30-31;1-6-4-2-3-5-7(6)11(8,9)10/h1-12,17H,13-16H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | OYAYFVMHSAUGSU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|