About 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine
2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine (PubChem CID 173196143) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine |
| PubChem CID | 173196143 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine |
| SMILES | CCCCCCSC1=NCC=C(C)N1 |
| InChI | InChI=1S/C11H20N2S/c1-3-4-5-6-9-14-11-12-8-7-10(2)13-11/h7H,3-6,8-9H2,1-2H3,(H,12,13) |
| InChIKey | FVIUSYSGUHPATL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine?
The IUPAC name of 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine (CID 173196143) is 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine.
What is the SMILES notation for 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine?
The canonical SMILES for 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine is CCCCCCSC1=NCC=C(C)N1.
What is the InChIKey of 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine?
The InChIKey is FVIUSYSGUHPATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-3-4-5-6-9-14-11-12-8-7-10(2)13-11/h7H,3-6,8-9H2,1-2H3,(H,12,13).
What are the key properties of 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine?
2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine has a molecular weight of 212.36 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylsulfanyl-6-methyl-1,4-dihydropyrimidine is sourced from PubChem (CID 173196143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).