C24H32O2 — CID 173196874
3-methyl-6-(5,5,8,8-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[b]naphthalen-3-yl)hexa-2,4-dienoic acid (PubChem CID 173196874) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 3-methyl-6-(5,5,8,8-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[b]naphthalen-3-yl)hexa-2,4-dienoic acid.
| Compound Name | 3-methyl-6-(5,5,8,8-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[b]naphthalen-3-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 173196874 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 3-methyl-6-(5,5,8,8-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[b]naphthalen-3-yl)hexa-2,4-dienoic acid |
| SMILES | CC(C=CCC1CCc2cc3c(cc21)C(C)(C)CCC3(C)C)=CC(=O)O |
| InChI | InChI=1S/C24H32O2/c1-16(13-22(25)26)7-6-8-17-9-10-18-14-20-21(15-19(17)18)24(4,5)12-11-23(20,2)3/h6-7,13-15,17H,8-12H2,1-5H3,(H,25,26) |
| InChIKey | OWDPUXAMBXGQSM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|