About potassium;hydride;3-methyloxadisilinane
potassium;hydride;3-methyloxadisilinane (PubChem CID 173196976) has the molecular formula C4H13KOSi2
and a molecular weight of 172.42 g/mol. Its IUPAC name is potassium;hydride;3-methyloxadisilinane.
Molecular Properties
| Compound Name | potassium;hydride;3-methyloxadisilinane |
| PubChem CID | 173196976 |
| Molecular Formula | C4H13KOSi2 |
| Molecular Weight | 172.42 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | potassium;hydride;3-methyloxadisilinane |
| SMILES | C[SiH]1CCCO[SiH2]1.[H-].[K+] |
| InChI | InChI=1S/C4H12OSi2.K.H/c1-7-4-2-3-5-6-7;;/h7H,2-4,6H2,1H3;;/q;+1;-1 |
| InChIKey | XBHWKFPAOPXKHI-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.42 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;3-methyloxadisilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;3-methyloxadisilinane?
The IUPAC name of potassium;hydride;3-methyloxadisilinane (CID 173196976) is potassium;hydride;3-methyloxadisilinane.
What is the SMILES notation for potassium;hydride;3-methyloxadisilinane?
The canonical SMILES for potassium;hydride;3-methyloxadisilinane is C[SiH]1CCCO[SiH2]1.[H-].[K+].
What is the InChIKey of potassium;hydride;3-methyloxadisilinane?
The InChIKey is XBHWKFPAOPXKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi2.K.H/c1-7-4-2-3-5-6-7;;/h7H,2-4,6H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;3-methyloxadisilinane?
potassium;hydride;3-methyloxadisilinane has a molecular weight of 172.42 g/mol, XLogP of -3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;3-methyloxadisilinane is sourced from PubChem (CID 173196976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).