C23H26N4 — CID 173197165
5,10,15-trimethyl-1,2,3,4,7,8,21,23-octahydroporphyrin (PubChem CID 173197165) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5,10,15-trimethyl-1,2,3,4,7,8,21,23-octahydroporphyrin.
| Compound Name | 5,10,15-trimethyl-1,2,3,4,7,8,21,23-octahydroporphyrin |
|---|---|
| PubChem CID | 173197165 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 5,10,15-trimethyl-1,2,3,4,7,8,21,23-octahydroporphyrin |
| SMILES | CC1=C2CCC(=N2)C(C)=c2ccc([nH]2)=C(C)C2=NC(=CC3CCC1N3)C=C2 |
| InChI | InChI=1S/C23H26N4/c1-13-18-6-4-16(24-18)12-17-5-7-19(25-17)14(2)21-9-11-23(27-21)15(3)22-10-8-20(13)26-22/h4,6,8,10,12,17,19,25-26H,5,7,9,11H2,1-3H3 |
| InChIKey | XEVVXPDJWCQMEP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |