About 3-oxido-1,3-thiazolidin-3-ium-2-ol
3-oxido-1,3-thiazolidin-3-ium-2-ol (PubChem CID 173197713) has the molecular formula C3H7NO2S
and a molecular weight of 121.16 g/mol. Its IUPAC name is 3-oxido-1,3-thiazolidin-3-ium-2-ol.
Molecular Properties
| Compound Name | 3-oxido-1,3-thiazolidin-3-ium-2-ol |
| PubChem CID | 173197713 |
| Molecular Formula | C3H7NO2S |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.02 |
| IUPAC Name | 3-oxido-1,3-thiazolidin-3-ium-2-ol |
| SMILES | [O-][NH+]1CCSC1O |
| InChI | InChI=1S/C3H7NO2S/c5-3-4(6)1-2-7-3/h3-5H,1-2H2 |
| InChIKey | JXJHCFOUWXTHSB-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxido-1,3-thiazolidin-3-ium-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxido-1,3-thiazolidin-3-ium-2-ol?
The IUPAC name of 3-oxido-1,3-thiazolidin-3-ium-2-ol (CID 173197713) is 3-oxido-1,3-thiazolidin-3-ium-2-ol.
What is the SMILES notation for 3-oxido-1,3-thiazolidin-3-ium-2-ol?
The canonical SMILES for 3-oxido-1,3-thiazolidin-3-ium-2-ol is [O-][NH+]1CCSC1O.
What is the InChIKey of 3-oxido-1,3-thiazolidin-3-ium-2-ol?
The InChIKey is JXJHCFOUWXTHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2S/c5-3-4(6)1-2-7-3/h3-5H,1-2H2.
What are the key properties of 3-oxido-1,3-thiazolidin-3-ium-2-ol?
3-oxido-1,3-thiazolidin-3-ium-2-ol has a molecular weight of 121.16 g/mol, XLogP of -1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxido-1,3-thiazolidin-3-ium-2-ol is sourced from PubChem (CID 173197713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).