C12H20 — CID 173198158
8a-methyl-2,4a,5,8-tetrahydro-1H-naphthalene;methane (PubChem CID 173198158) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 8a-methyl-2,4a,5,8-tetrahydro-1H-naphthalene;methane.
| Compound Name | 8a-methyl-2,4a,5,8-tetrahydro-1H-naphthalene;methane |
|---|---|
| PubChem CID | 173198158 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 8a-methyl-2,4a,5,8-tetrahydro-1H-naphthalene;methane |
| SMILES | C.CC12CC=CCC1C=CCC2 |
| InChI | InChI=1S/C11H16.CH4/c1-11-8-4-2-6-10(11)7-3-5-9-11;/h2-4,7,10H,5-6,8-9H2,1H3;1H4 |
| InChIKey | ZFNKIGXIPJPKOY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|