About 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium
2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium (PubChem CID 173199010) has the molecular formula C19H39N4+
and a molecular weight of 323.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium |
| PubChem CID | 173199010 |
| Molecular Formula | C19H39N4+ |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium |
| SMILES | C=CCC(C=C)(NCN1CCCCC1)[NH+](C)CCN(CC)CC |
| InChI | InChI=1S/C19H38N4/c1-6-13-19(7-2,20-18-23-14-11-10-12-15-23)21(5)16-17-22(8-3)9-4/h6-7,20H,1-2,8-18H2,3-5H3/p+1 |
| InChIKey | DNQDLRVTTKAUQY-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 22.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium?
The IUPAC name of 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium (CID 173199010) is 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium.
What is the SMILES notation for 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium?
The canonical SMILES for 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium is C=CCC(C=C)(NCN1CCCCC1)[NH+](C)CCN(CC)CC.
What is the InChIKey of 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium?
The InChIKey is DNQDLRVTTKAUQY-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H38N4/c1-6-13-19(7-2,20-18-23-14-11-10-12-15-23)21(5)16-17-22(8-3)9-4/h6-7,20H,1-2,8-18H2,3-5H3/p+1.
What are the key properties of 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium?
2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium has a molecular weight of 323.55 g/mol, XLogP of 1.33, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl-methyl-[3-(piperidin-1-ylmethylamino)hexa-1,5-dien-3-yl]azanium is sourced from PubChem (CID 173199010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).